C17H23NO9 — CID 140522712
11-[2-(tert-butylamino)-1-hydroxyethyl]-4,5,9-trihydroxy-10-(hydroxymethyl)-2,7-dioxabicyclo[6.2.2]dodeca-1(10),8,11-triene-3,6-dione (PubChem CID 140522712) has the molecular formula C17H23NO9 and a molecular weight of 385.37 g/mol. Its IUPAC name is 11-[2-(tert-butylamino)-1-hydroxyethyl]-4,5,9-trihydroxy-10-(hydroxymethyl)-2,7-dioxabicyclo[6.2.2]dodeca-1(10),8,11-triene-3,6-dione.
| Compound Name | 11-[2-(tert-butylamino)-1-hydroxyethyl]-4,5,9-trihydroxy-10-(hydroxymethyl)-2,7-dioxabicyclo[6.2.2]dodeca-1(10),8,11-triene-3,6-dione |
|---|---|
| PubChem CID | 140522712 |
| Molecular Formula | C17H23NO9 |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 11-[2-(tert-butylamino)-1-hydroxyethyl]-4,5,9-trihydroxy-10-(hydroxymethyl)-2,7-dioxabicyclo[6.2.2]dodeca-1(10),8,11-triene-3,6-dione |
| SMILES | CC(C)(C)NCC(O)c1cc2c(O)c(CO)c1OC(=O)C(O)C(O)C(=O)O2 |
| InChI | InChI=1S/C17H23NO9/c1-17(2,3)18-5-9(20)7-4-10-11(21)8(6-19)14(7)27-16(25)13(23)12(22)15(24)26-10/h4,9,12-13,18-23H,5-6H2,1-3H3 |
| InChIKey | MFFFMEVJBPNKFM-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 165.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|