C15H24O5 — CID 140523028
2-[(3,4-dihydroxycyclohexyl)methyl]-6-hydroxy-3a,4,5,6,7,7a-hexahydro-1-benzofuran-3-one (PubChem CID 140523028) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is 2-[(3,4-dihydroxycyclohexyl)methyl]-6-hydroxy-3a,4,5,6,7,7a-hexahydro-1-benzofuran-3-one.
| Compound Name | 2-[(3,4-dihydroxycyclohexyl)methyl]-6-hydroxy-3a,4,5,6,7,7a-hexahydro-1-benzofuran-3-one |
|---|---|
| PubChem CID | 140523028 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 2-[(3,4-dihydroxycyclohexyl)methyl]-6-hydroxy-3a,4,5,6,7,7a-hexahydro-1-benzofuran-3-one |
| SMILES | O=C1C(CC2CCC(O)C(O)C2)OC2CC(O)CCC12 |
| InChI | InChI=1S/C15H24O5/c16-9-2-3-10-13(7-9)20-14(15(10)19)6-8-1-4-11(17)12(18)5-8/h8-14,16-18H,1-7H2 |
| InChIKey | FTZSXEVLWPQPBB-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |