C20H34O7 — CID 140523036
(E)-3-(2,4-dimethoxycyclohexyl)-1-(6-hydroxy-2,3,4-trimethoxycyclohexyl)prop-2-en-1-one (PubChem CID 140523036) has the molecular formula C20H34O7 and a molecular weight of 386.49 g/mol. Its IUPAC name is (E)-3-(2,4-dimethoxycyclohexyl)-1-(6-hydroxy-2,3,4-trimethoxycyclohexyl)prop-2-en-1-one.
| Compound Name | (E)-3-(2,4-dimethoxycyclohexyl)-1-(6-hydroxy-2,3,4-trimethoxycyclohexyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 140523036 |
| Molecular Formula | C20H34O7 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | (E)-3-(2,4-dimethoxycyclohexyl)-1-(6-hydroxy-2,3,4-trimethoxycyclohexyl)prop-2-en-1-one |
| SMILES | COC1CCC(/C=C/C(=O)C2C(O)CC(OC)C(OC)C2OC)C(OC)C1 |
| InChI | InChI=1S/C20H34O7/c1-23-13-8-6-12(16(10-13)24-2)7-9-14(21)18-15(22)11-17(25-3)19(26-4)20(18)27-5/h7,9,12-13,15-20,22H,6,8,10-11H2,1-5H3/b9-7+ |
| InChIKey | FLRPMKOPAZCIGK-VQHVLOKHSA-N |
| XLogP | 1.37 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|