C25H24FN5O2 — CID 140524395
4-[fluoro-[3-methyl-4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-2-(1H-indol-2-yl)-1,3-oxazole (PubChem CID 140524395) has the molecular formula C25H24FN5O2 and a molecular weight of 445.50 g/mol. Its IUPAC name is 4-[fluoro-[3-methyl-4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-2-(1H-indol-2-yl)-1,3-oxazole.
| Compound Name | 4-[fluoro-[3-methyl-4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-2-(1H-indol-2-yl)-1,3-oxazole |
|---|---|
| PubChem CID | 140524395 |
| Molecular Formula | C25H24FN5O2 |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 4-[fluoro-[3-methyl-4-[4-(triazol-1-yl)butyl]phenoxy]methyl]-2-(1H-indol-2-yl)-1,3-oxazole |
| SMILES | Cc1cc(OC(F)c2coc(-c3cc4ccccc4[nH]3)n2)ccc1CCCCn1ccnn1 |
| InChI | InChI=1S/C25H24FN5O2/c1-17-14-20(10-9-18(17)6-4-5-12-31-13-11-27-30-31)33-24(26)23-16-32-25(29-23)22-15-19-7-2-3-8-21(19)28-22/h2-3,7-11,13-16,24,28H,4-6,12H2,1H3 |
| InChIKey | XYUDHKZNSISYEX-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|