About 1-azoniatricyclo[3.3.1.02,4]nonane bromide
1-azoniatricyclo[3.3.1.02,4]nonane bromide (PubChem CID 140524578) has the molecular formula C8H14BrN
and a molecular weight of 204.11 g/mol. Its IUPAC name is 1-azoniatricyclo[3.3.1.02,4]nonane bromide.
Molecular Properties
| Compound Name | 1-azoniatricyclo[3.3.1.02,4]nonane bromide |
| PubChem CID | 140524578 |
| Molecular Formula | C8H14BrN |
| Molecular Weight | 204.11 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 1-azoniatricyclo[3.3.1.02,4]nonane bromide |
| SMILES | C1CC2C[NH+](C1)C1CC21.[Br-] |
| InChI | InChI=1S/C8H13N.BrH/c1-2-6-5-9(3-1)8-4-7(6)8;/h6-8H,1-5H2;1H |
| InChIKey | MJAISXFMVDJLCZ-UHFFFAOYSA-N |
| XLogP | -3.31 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.11 |
| LogP ≤ 5 | -3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-azoniatricyclo[3.3.1.02,4]nonane bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azoniatricyclo[3.3.1.02,4]nonane bromide?
The IUPAC name of 1-azoniatricyclo[3.3.1.02,4]nonane bromide (CID 140524578) is 1-azoniatricyclo[3.3.1.02,4]nonane bromide.
What is the SMILES notation for 1-azoniatricyclo[3.3.1.02,4]nonane bromide?
The canonical SMILES for 1-azoniatricyclo[3.3.1.02,4]nonane bromide is C1CC2C[NH+](C1)C1CC21.[Br-].
What is the InChIKey of 1-azoniatricyclo[3.3.1.02,4]nonane bromide?
The InChIKey is MJAISXFMVDJLCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N.BrH/c1-2-6-5-9(3-1)8-4-7(6)8;/h6-8H,1-5H2;1H.
What are the key properties of 1-azoniatricyclo[3.3.1.02,4]nonane bromide?
1-azoniatricyclo[3.3.1.02,4]nonane bromide has a molecular weight of 204.11 g/mol, XLogP of -3.31, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azoniatricyclo[3.3.1.02,4]nonane bromide is sourced from PubChem (CID 140524578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).