C15H24N2O2 — CID 140524680
hexa-1,3-dienyl 2-(3-butyl-2H-imidazol-1-yl)acetate (PubChem CID 140524680) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is hexa-1,3-dienyl 2-(3-butyl-2H-imidazol-1-yl)acetate.
| Compound Name | hexa-1,3-dienyl 2-(3-butyl-2H-imidazol-1-yl)acetate |
|---|---|
| PubChem CID | 140524680 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | hexa-1,3-dienyl 2-(3-butyl-2H-imidazol-1-yl)acetate |
| SMILES | CCC=CC=COC(=O)CN1C=CN(CCCC)C1 |
| InChI | InChI=1S/C15H24N2O2/c1-3-5-7-8-12-19-15(18)13-17-11-10-16(14-17)9-6-4-2/h5,7-8,10-12H,3-4,6,9,13-14H2,1-2H3 |
| InChIKey | IFOSCCUYLLIWQV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|