C20H16F7N3O2S — CID 140525134
3-[4-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)phenyl]-5-(2-pyridin-4-ylpropan-2-yl)imidazolidine-2,4-dione (PubChem CID 140525134) has the molecular formula C20H16F7N3O2S and a molecular weight of 495.42 g/mol. Its IUPAC name is 3-[4-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)phenyl]-5-(2-pyridin-4-ylpropan-2-yl)imidazolidine-2,4-dione.
| Compound Name | 3-[4-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)phenyl]-5-(2-pyridin-4-ylpropan-2-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 140525134 |
| Molecular Formula | C20H16F7N3O2S |
| Molecular Weight | 495.42 g/mol |
| Exact Mass | 495.09 |
| IUPAC Name | 3-[4-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)phenyl]-5-(2-pyridin-4-ylpropan-2-yl)imidazolidine-2,4-dione |
| SMILES | CC(C)(c1ccncc1)C1NC(=O)N(c2ccc(SC(F)(F)C(F)(F)C(F)(F)F)cc2)C1=O |
| InChI | InChI=1S/C20H16F7N3O2S/c1-17(2,11-7-9-28-10-8-11)14-15(31)30(16(32)29-14)12-3-5-13(6-4-12)33-20(26,27)18(21,22)19(23,24)25/h3-10,14H,1-2H3,(H,29,32) |
| InChIKey | IQAXBHGNDMNOGE-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.42 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|