C40H42Zr — CID 140525343
benzhydrylidenezirconium(2+);2-tert-butyl-5-methylcyclopenta-1,3-diene;2,3,6,7-tetramethyl-1,9-dihydrofluoren-1-ide (PubChem CID 140525343) has the molecular formula C40H42Zr and a molecular weight of 614.00 g/mol. Its IUPAC name is benzhydrylidenezirconium(2+);2-tert-butyl-5-methylcyclopenta-1,3-diene;2,3,6,7-tetramethyl-1,9-dihydrofluoren-1-ide.
| Compound Name | benzhydrylidenezirconium(2+);2-tert-butyl-5-methylcyclopenta-1,3-diene;2,3,6,7-tetramethyl-1,9-dihydrofluoren-1-ide |
|---|---|
| PubChem CID | 140525343 |
| Molecular Formula | C40H42Zr |
| Molecular Weight | 614.00 g/mol |
| Exact Mass | 612.23 |
| IUPAC Name | benzhydrylidenezirconium(2+);2-tert-butyl-5-methylcyclopenta-1,3-diene;2,3,6,7-tetramethyl-1,9-dihydrofluoren-1-ide |
| SMILES | CC1[C-]=CC(C(C)(C)C)=C1.Cc1[c-]c2c(cc1C)-c1cc(C)c(C)cc1C2.[Zr+2]=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H17.C13H10.C10H15.Zr/c1-10-5-14-9-15-6-11(2)13(4)8-17(15)16(14)7-12(10)3;1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;1-8-5-6-9(7-8)10(2,3)4;/h5,7-8H,9H2,1-4H3;1-10H;6-8H,1-4H3;/q-1;;-1;+2 |
| InChIKey | HLSCPHIZHASLCL-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.00 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|