C19H14FN7O3 — CID 140525674
6-[(4R)-8-fluoro-3,4-dihydro-2H-chromen-4-yl]-2-imidazo[4,5-c]pyridin-3-yl-5-nitropyrimidin-4-amine (PubChem CID 140525674) has the molecular formula C19H14FN7O3 and a molecular weight of 407.37 g/mol. Its IUPAC name is 6-[(4R)-8-fluoro-3,4-dihydro-2H-chromen-4-yl]-2-imidazo[4,5-c]pyridin-3-yl-5-nitropyrimidin-4-amine.
| Compound Name | 6-[(4R)-8-fluoro-3,4-dihydro-2H-chromen-4-yl]-2-imidazo[4,5-c]pyridin-3-yl-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 140525674 |
| Molecular Formula | C19H14FN7O3 |
| Molecular Weight | 407.37 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 6-[(4R)-8-fluoro-3,4-dihydro-2H-chromen-4-yl]-2-imidazo[4,5-c]pyridin-3-yl-5-nitropyrimidin-4-amine |
| SMILES | Nc1nc(-n2cnc3ccncc32)nc([C@@H]2CCOc3c(F)cccc32)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H14FN7O3/c20-12-3-1-2-11-10(5-7-30-17(11)12)15-16(27(28)29)18(21)25-19(24-15)26-9-23-13-4-6-22-8-14(13)26/h1-4,6,8-10H,5,7H2,(H2,21,24,25)/t10-/m1/s1 |
| InChIKey | DIBUNZTUOGPJGG-SNVBAGLBSA-N |
| XLogP | 2.75 |
| TPSA | 134.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|