C20H26S — CID 140525873
3-(3-tert-butylcyclopenta-1,3-dien-1-yl)-2-methyl-1-propan-2-ylidene-2H-cyclopenta[b]thiophene (PubChem CID 140525873) has the molecular formula C20H26S and a molecular weight of 298.50 g/mol. Its IUPAC name is 3-(3-tert-butylcyclopenta-1,3-dien-1-yl)-2-methyl-1-propan-2-ylidene-2H-cyclopenta[b]thiophene.
| Compound Name | 3-(3-tert-butylcyclopenta-1,3-dien-1-yl)-2-methyl-1-propan-2-ylidene-2H-cyclopenta[b]thiophene |
|---|---|
| PubChem CID | 140525873 |
| Molecular Formula | C20H26S |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 3-(3-tert-butylcyclopenta-1,3-dien-1-yl)-2-methyl-1-propan-2-ylidene-2H-cyclopenta[b]thiophene |
| SMILES | CC(C)=S1C2=CC=CC2=C(C2=CC(C(C)(C)C)=CC2)C1C |
| InChI | InChI=1S/C20H26S/c1-13(2)21-14(3)19(17-8-7-9-18(17)21)15-10-11-16(12-15)20(4,5)6/h7-9,11-12,14H,10H2,1-6H3 |
| InChIKey | PRZSJQAGZZDSJP-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|