C21H35Cl2N11O — CID 140526291
3,5-diamino-6-chloro-N-[N'-[4-[4-[4-(1H-imidazol-2-yl)butyl]piperazin-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide;hydrochloride (PubChem CID 140526291) has the molecular formula C21H35Cl2N11O and a molecular weight of 528.49 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-[4-[4-(1H-imidazol-2-yl)butyl]piperazin-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide;hydrochloride.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[4-(1H-imidazol-2-yl)butyl]piperazin-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 140526291 |
| Molecular Formula | C21H35Cl2N11O |
| Molecular Weight | 528.49 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[4-(1H-imidazol-2-yl)butyl]piperazin-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide;hydrochloride |
| SMILES | Cl.N/C(=N\CCCCN1CCN(CCCCc2ncc[nH]2)CC1)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C21H34ClN11O.ClH/c22-17-19(24)30-18(23)16(29-17)20(34)31-21(25)28-6-2-4-10-33-13-11-32(12-14-33)9-3-1-5-15-26-7-8-27-15;/h7-8H,1-6,9-14H2,(H,26,27)(H4,23,24,30)(H3,25,28,31,34);1H |
| InChIKey | YKVQWNVUNQDRFP-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 180.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.49 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|