C28H32FN9 — CID 140526503
1-(3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-5-yl)-3-N-[3-fluoro-4-[methyl(piperidin-4-ylmethyl)amino]phenyl]-1,2,4-triazole-3,5-diamine (PubChem CID 140526503) has the molecular formula C28H32FN9 and a molecular weight of 513.63 g/mol. Its IUPAC name is 1-(3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-5-yl)-3-N-[3-fluoro-4-[methyl(piperidin-4-ylmethyl)amino]phenyl]-1,2,4-triazole-3,5-diamine.
| Compound Name | 1-(3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-5-yl)-3-N-[3-fluoro-4-[methyl(piperidin-4-ylmethyl)amino]phenyl]-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 140526503 |
| Molecular Formula | C28H32FN9 |
| Molecular Weight | 513.63 g/mol |
| Exact Mass | 513.28 |
| IUPAC Name | 1-(3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-5-yl)-3-N-[3-fluoro-4-[methyl(piperidin-4-ylmethyl)amino]phenyl]-1,2,4-triazole-3,5-diamine |
| SMILES | CN(CC1CCNCC1)c1ccc(Nc2nc(N)n(-c3cc4c(nn3)-c3ccccc3CCC4)n2)cc1F |
| InChI | InChI=1S/C28H32FN9/c1-37(17-18-11-13-31-14-12-18)24-10-9-21(16-23(24)29)32-28-33-27(30)38(36-28)25-15-20-7-4-6-19-5-2-3-8-22(19)26(20)35-34-25/h2-3,5,8-10,15-16,18,31H,4,6-7,11-14,17H2,1H3,(H3,30,32,33,36) |
| InChIKey | ZQPIWWJWCRLTPW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 109.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.63 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|