About N-[2,2-dichloro-1-[chloro(triphenyl)-λ5-phosphanyl]ethenyl]-2-fluoroacetamide
N-[2,2-dichloro-1-[chloro(triphenyl)-λ5-phosphanyl]ethenyl]-2-fluoroacetamide (PubChem CID 140527072) has the molecular formula C22H18Cl3FNOP
and a molecular weight of 468.72 g/mol. Its IUPAC name is N-[2,2-dichloro-1-[chloro(triphenyl)-λ5-phosphanyl]ethenyl]-2-fluoroacetamide.
Molecular Properties
| Compound Name | N-[2,2-dichloro-1-[chloro(triphenyl)-λ5-phosphanyl]ethenyl]-2-fluoroacetamide |
| PubChem CID | 140527072 |
| Molecular Formula | C22H18Cl3FNOP |
| Molecular Weight | 468.72 g/mol |
| Exact Mass | 467.02 |
| IUPAC Name | N-[2,2-dichloro-1-[chloro(triphenyl)-λ5-phosphanyl]ethenyl]-2-fluoroacetamide |
| SMILES | O=C(CF)NC(=C(Cl)Cl)P(Cl)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H18Cl3FNOP/c23-21(24)22(27-20(28)16-26)29(25,17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15H,16H2,(H,27,28) |
| InChIKey | MGVXMQYKUSOENM-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.72 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-[2,2-dichloro-1-[chloro(triphenyl)-λ5-phosphanyl]ethenyl]-2-fluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,2-dichloro-1-[chloro(triphenyl)-λ5-phosphanyl]ethenyl]-2-fluoroacetamide?
The IUPAC name of N-[2,2-dichloro-1-[chloro(triphenyl)-λ5-phosphanyl]ethenyl]-2-fluoroacetamide (CID 140527072) is N-[2,2-dichloro-1-[chloro(triphenyl)-λ5-phosphanyl]ethenyl]-2-fluoroacetamide.
What is the SMILES notation for N-[2,2-dichloro-1-[chloro(triphenyl)-λ5-phosphanyl]ethenyl]-2-fluoroacetamide?
The canonical SMILES for N-[2,2-dichloro-1-[chloro(triphenyl)-λ5-phosphanyl]ethenyl]-2-fluoroacetamide is O=C(CF)NC(=C(Cl)Cl)P(Cl)(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of N-[2,2-dichloro-1-[chloro(triphenyl)-λ5-phosphanyl]ethenyl]-2-fluoroacetamide?
The InChIKey is MGVXMQYKUSOENM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18Cl3FNOP/c23-21(24)22(27-20(28)16-26)29(25,17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15H,16H2,(H,27,28).
What are the key properties of N-[2,2-dichloro-1-[chloro(triphenyl)-λ5-phosphanyl]ethenyl]-2-fluoroacetamide?
N-[2,2-dichloro-1-[chloro(triphenyl)-λ5-phosphanyl]ethenyl]-2-fluoroacetamide has a molecular weight of 468.72 g/mol, XLogP of 5.36, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,2-dichloro-1-[chloro(triphenyl)-λ5-phosphanyl]ethenyl]-2-fluoroacetamide is sourced from PubChem (CID 140527072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).