About (5E)-5-methoxyimino-5λ4-thia-1-azabicyclo[4.2.0]oct-2-en-8-one
(5E)-5-methoxyimino-5λ4-thia-1-azabicyclo[4.2.0]oct-2-en-8-one (PubChem CID 140527520) has the molecular formula C7H10N2O2S
and a molecular weight of 186.24 g/mol. Its IUPAC name is (5E)-5-methoxyimino-5λ4-thia-1-azabicyclo[4.2.0]oct-2-en-8-one.
Molecular Properties
| Compound Name | (5E)-5-methoxyimino-5λ4-thia-1-azabicyclo[4.2.0]oct-2-en-8-one |
| PubChem CID | 140527520 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | (5E)-5-methoxyimino-5λ4-thia-1-azabicyclo[4.2.0]oct-2-en-8-one |
| SMILES | CO/N=S1\CC=CN2C(=O)CC21 |
| InChI | InChI=1S/C7H10N2O2S/c1-11-8-12-4-2-3-9-6(10)5-7(9)12/h2-3,7H,4-5H2,1H3 |
| InChIKey | ALOHNYAZHRLCHA-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (5E)-5-methoxyimino-5λ4-thia-1-azabicyclo[4.2.0]oct-2-en-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-5-methoxyimino-5λ4-thia-1-azabicyclo[4.2.0]oct-2-en-8-one?
The IUPAC name of (5E)-5-methoxyimino-5λ4-thia-1-azabicyclo[4.2.0]oct-2-en-8-one (CID 140527520) is (5E)-5-methoxyimino-5λ4-thia-1-azabicyclo[4.2.0]oct-2-en-8-one.
What is the SMILES notation for (5E)-5-methoxyimino-5λ4-thia-1-azabicyclo[4.2.0]oct-2-en-8-one?
The canonical SMILES for (5E)-5-methoxyimino-5λ4-thia-1-azabicyclo[4.2.0]oct-2-en-8-one is CO/N=S1\CC=CN2C(=O)CC21.
What is the InChIKey of (5E)-5-methoxyimino-5λ4-thia-1-azabicyclo[4.2.0]oct-2-en-8-one?
The InChIKey is ALOHNYAZHRLCHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2S/c1-11-8-12-4-2-3-9-6(10)5-7(9)12/h2-3,7H,4-5H2,1H3.
What are the key properties of (5E)-5-methoxyimino-5λ4-thia-1-azabicyclo[4.2.0]oct-2-en-8-one?
(5E)-5-methoxyimino-5λ4-thia-1-azabicyclo[4.2.0]oct-2-en-8-one has a molecular weight of 186.24 g/mol, XLogP of 0.44, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-5-methoxyimino-5λ4-thia-1-azabicyclo[4.2.0]oct-2-en-8-one is sourced from PubChem (CID 140527520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).