About butyl-chloro-triphenyl-λ5-arsane
butyl-chloro-triphenyl-λ5-arsane (PubChem CID 140527829) has the molecular formula C22H24AsCl
and a molecular weight of 398.81 g/mol. Its IUPAC name is butyl-chloro-triphenyl-λ5-arsane.
Molecular Properties
| Compound Name | butyl-chloro-triphenyl-λ5-arsane |
| PubChem CID | 140527829 |
| Molecular Formula | C22H24AsCl |
| Molecular Weight | 398.81 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | butyl-chloro-triphenyl-λ5-arsane |
| SMILES | CCCC[As](Cl)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H24AsCl/c1-2-3-19-23(24,20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22/h4-18H,2-3,19H2,1H3 |
| InChIKey | ZJWWYJBFLNPCDR-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.81 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze butyl-chloro-triphenyl-λ5-arsane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl-chloro-triphenyl-λ5-arsane?
The IUPAC name of butyl-chloro-triphenyl-λ5-arsane (CID 140527829) is butyl-chloro-triphenyl-λ5-arsane.
What is the SMILES notation for butyl-chloro-triphenyl-λ5-arsane?
The canonical SMILES for butyl-chloro-triphenyl-λ5-arsane is CCCC[As](Cl)(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of butyl-chloro-triphenyl-λ5-arsane?
The InChIKey is ZJWWYJBFLNPCDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24AsCl/c1-2-3-19-23(24,20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22/h4-18H,2-3,19H2,1H3.
What are the key properties of butyl-chloro-triphenyl-λ5-arsane?
butyl-chloro-triphenyl-λ5-arsane has a molecular weight of 398.81 g/mol, XLogP of 4.65, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butyl-chloro-triphenyl-λ5-arsane is sourced from PubChem (CID 140527829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).