About bromo-triheptyl-pentyl-λ5-phosphane
bromo-triheptyl-pentyl-λ5-phosphane (PubChem CID 140527924) has the molecular formula C26H56BrP
and a molecular weight of 479.61 g/mol. Its IUPAC name is bromo-triheptyl-pentyl-λ5-phosphane.
Molecular Properties
| Compound Name | bromo-triheptyl-pentyl-λ5-phosphane |
| PubChem CID | 140527924 |
| Molecular Formula | C26H56BrP |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 478.33 |
| IUPAC Name | bromo-triheptyl-pentyl-λ5-phosphane |
| SMILES | CCCCCCCP(Br)(CCCCC)(CCCCCCC)CCCCCCC |
| InChI | InChI=1S/C26H56BrP/c1-5-9-13-16-20-24-28(27,23-19-12-8-4,25-21-17-14-10-6-2)26-22-18-15-11-7-3/h5-26H2,1-4H3 |
| InChIKey | NDSSRHZMZJXZOK-UHFFFAOYSA-N |
| XLogP | 10.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 22 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bromo-triheptyl-pentyl-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromo-triheptyl-pentyl-λ5-phosphane?
The IUPAC name of bromo-triheptyl-pentyl-λ5-phosphane (CID 140527924) is bromo-triheptyl-pentyl-λ5-phosphane.
What is the SMILES notation for bromo-triheptyl-pentyl-λ5-phosphane?
The canonical SMILES for bromo-triheptyl-pentyl-λ5-phosphane is CCCCCCCP(Br)(CCCCC)(CCCCCCC)CCCCCCC.
What is the InChIKey of bromo-triheptyl-pentyl-λ5-phosphane?
The InChIKey is NDSSRHZMZJXZOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H56BrP/c1-5-9-13-16-20-24-28(27,23-19-12-8-4,25-21-17-14-10-6-2)26-22-18-15-11-7-3/h5-26H2,1-4H3.
What are the key properties of bromo-triheptyl-pentyl-λ5-phosphane?
bromo-triheptyl-pentyl-λ5-phosphane has a molecular weight of 479.61 g/mol, XLogP of 10.95, 22 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bromo-triheptyl-pentyl-λ5-phosphane is sourced from PubChem (CID 140527924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).