C23H38FNO5Si — CID 140529224
tert-butyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-5-fluoro-3-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 140529224) has the molecular formula C23H38FNO5Si and a molecular weight of 455.64 g/mol. Its IUPAC name is tert-butyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-5-fluoro-3-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | tert-butyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-5-fluoro-3-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 140529224 |
| Molecular Formula | C23H38FNO5Si |
| Molecular Weight | 455.64 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | tert-butyl (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-5-fluoro-3-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | CC(C)(C)OC(=O)C[C@@H](NC(=O)OCc1ccccc1)[C@@H](CF)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H38FNO5Si/c1-22(2,3)29-20(26)14-18(19(15-24)30-31(7,8)23(4,5)6)25-21(27)28-16-17-12-10-9-11-13-17/h9-13,18-19H,14-16H2,1-8H3,(H,25,27)/t18-,19-/m1/s1 |
| InChIKey | HOPUXRGALNWGTG-RTBURBONSA-N |
| XLogP | 5.37 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.64 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|