C10H16Br3NO2S — CID 140529342
2-(tribromomethylsulfonyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline (PubChem CID 140529342) has the molecular formula C10H16Br3NO2S and a molecular weight of 454.02 g/mol. Its IUPAC name is 2-(tribromomethylsulfonyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline.
| Compound Name | 2-(tribromomethylsulfonyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline |
|---|---|
| PubChem CID | 140529342 |
| Molecular Formula | C10H16Br3NO2S |
| Molecular Weight | 454.02 g/mol |
| Exact Mass | 450.85 |
| IUPAC Name | 2-(tribromomethylsulfonyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline |
| SMILES | O=S(=O)(C1CCC2CCCCC2N1)C(Br)(Br)Br |
| InChI | InChI=1S/C10H16Br3NO2S/c11-10(12,13)17(15,16)9-6-5-7-3-1-2-4-8(7)14-9/h7-9,14H,1-6H2 |
| InChIKey | BNUFTNMMOPIRHJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.02 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|