C22H22N2O2 — CID 140529749
2-[(2-hydroxy-2-phenylethyl)amino]-N,N-diphenylacetamide (PubChem CID 140529749) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is 2-[(2-hydroxy-2-phenylethyl)amino]-N,N-diphenylacetamide.
| Compound Name | 2-[(2-hydroxy-2-phenylethyl)amino]-N,N-diphenylacetamide |
|---|---|
| PubChem CID | 140529749 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 2-[(2-hydroxy-2-phenylethyl)amino]-N,N-diphenylacetamide |
| SMILES | O=C(CNCC(O)c1ccccc1)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H22N2O2/c25-21(18-10-4-1-5-11-18)16-23-17-22(26)24(19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15,21,23,25H,16-17H2 |
| InChIKey | TUMDEFFBIFCEGL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |