About tert-butyl 2-[4-(5-bromo-1,3,4-thiadiazol-2-yl)-3-methylphenyl]propanoate
tert-butyl 2-[4-(5-bromo-1,3,4-thiadiazol-2-yl)-3-methylphenyl]propanoate (PubChem CID 140529795) has the molecular formula C16H19BrN2O2S
and a molecular weight of 383.31 g/mol. Its IUPAC name is tert-butyl 2-[4-(5-bromo-1,3,4-thiadiazol-2-yl)-3-methylphenyl]propanoate.
Molecular Properties
| Compound Name | tert-butyl 2-[4-(5-bromo-1,3,4-thiadiazol-2-yl)-3-methylphenyl]propanoate |
| PubChem CID | 140529795 |
| Molecular Formula | C16H19BrN2O2S |
| Molecular Weight | 383.31 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | tert-butyl 2-[4-(5-bromo-1,3,4-thiadiazol-2-yl)-3-methylphenyl]propanoate |
| SMILES | Cc1cc(C(C)C(=O)OC(C)(C)C)ccc1-c1nnc(Br)s1 |
| InChI | InChI=1S/C16H19BrN2O2S/c1-9-8-11(10(2)14(20)21-16(3,4)5)6-7-12(9)13-18-19-15(17)22-13/h6-8,10H,1-5H3 |
| InChIKey | RHJWFDCIQZRSKE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.31 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 2-[4-(5-bromo-1,3,4-thiadiazol-2-yl)-3-methylphenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[4-(5-bromo-1,3,4-thiadiazol-2-yl)-3-methylphenyl]propanoate?
The IUPAC name of tert-butyl 2-[4-(5-bromo-1,3,4-thiadiazol-2-yl)-3-methylphenyl]propanoate (CID 140529795) is tert-butyl 2-[4-(5-bromo-1,3,4-thiadiazol-2-yl)-3-methylphenyl]propanoate.
What is the SMILES notation for tert-butyl 2-[4-(5-bromo-1,3,4-thiadiazol-2-yl)-3-methylphenyl]propanoate?
The canonical SMILES for tert-butyl 2-[4-(5-bromo-1,3,4-thiadiazol-2-yl)-3-methylphenyl]propanoate is Cc1cc(C(C)C(=O)OC(C)(C)C)ccc1-c1nnc(Br)s1.
What is the InChIKey of tert-butyl 2-[4-(5-bromo-1,3,4-thiadiazol-2-yl)-3-methylphenyl]propanoate?
The InChIKey is RHJWFDCIQZRSKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19BrN2O2S/c1-9-8-11(10(2)14(20)21-16(3,4)5)6-7-12(9)13-18-19-15(17)22-13/h6-8,10H,1-5H3.
What are the key properties of tert-butyl 2-[4-(5-bromo-1,3,4-thiadiazol-2-yl)-3-methylphenyl]propanoate?
tert-butyl 2-[4-(5-bromo-1,3,4-thiadiazol-2-yl)-3-methylphenyl]propanoate has a molecular weight of 383.31 g/mol, XLogP of 4.72, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[4-(5-bromo-1,3,4-thiadiazol-2-yl)-3-methylphenyl]propanoate is sourced from PubChem (CID 140529795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).