About 3-(4-fluorophenyl)-N'-hydroxypropanimidamide
3-(4-fluorophenyl)-N'-hydroxypropanimidamide (PubChem CID 140529999) has the molecular formula C9H11FN2O
and a molecular weight of 182.20 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N'-hydroxypropanimidamide.
Molecular Properties
| Compound Name | 3-(4-fluorophenyl)-N'-hydroxypropanimidamide |
| PubChem CID | 140529999 |
| Molecular Formula | C9H11FN2O |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 3-(4-fluorophenyl)-N'-hydroxypropanimidamide |
| SMILES | N/C(CCc1ccc(F)cc1)=N\O |
| InChI | InChI=1S/C9H11FN2O/c10-8-4-1-7(2-5-8)3-6-9(11)12-13/h1-2,4-5,13H,3,6H2,(H2,11,12) |
| InChIKey | CKWKCFUCIMSRNG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-fluorophenyl)-N'-hydroxypropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-fluorophenyl)-N'-hydroxypropanimidamide?
The IUPAC name of 3-(4-fluorophenyl)-N'-hydroxypropanimidamide (CID 140529999) is 3-(4-fluorophenyl)-N'-hydroxypropanimidamide.
What is the SMILES notation for 3-(4-fluorophenyl)-N'-hydroxypropanimidamide?
The canonical SMILES for 3-(4-fluorophenyl)-N'-hydroxypropanimidamide is N/C(CCc1ccc(F)cc1)=N\O.
What is the InChIKey of 3-(4-fluorophenyl)-N'-hydroxypropanimidamide?
The InChIKey is CKWKCFUCIMSRNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FN2O/c10-8-4-1-7(2-5-8)3-6-9(11)12-13/h1-2,4-5,13H,3,6H2,(H2,11,12).
What are the key properties of 3-(4-fluorophenyl)-N'-hydroxypropanimidamide?
3-(4-fluorophenyl)-N'-hydroxypropanimidamide has a molecular weight of 182.20 g/mol, XLogP of 1.50, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluorophenyl)-N'-hydroxypropanimidamide is sourced from PubChem (CID 140529999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).