C19H16F3N3O4 — CID 140530160
[3-[5-(4-butoxyphenyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl] 2,2,2-trifluoroacetate (PubChem CID 140530160) has the molecular formula C19H16F3N3O4 and a molecular weight of 407.35 g/mol. Its IUPAC name is [3-[5-(4-butoxyphenyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl] 2,2,2-trifluoroacetate.
| Compound Name | [3-[5-(4-butoxyphenyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140530160 |
| Molecular Formula | C19H16F3N3O4 |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | [3-[5-(4-butoxyphenyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl] 2,2,2-trifluoroacetate |
| SMILES | CCCCOc1ccc(-c2nnc(-c3cccnc3OC(=O)C(F)(F)F)o2)cc1 |
| InChI | InChI=1S/C19H16F3N3O4/c1-2-3-11-27-13-8-6-12(7-9-13)15-24-25-17(28-15)14-5-4-10-23-16(14)29-18(26)19(20,21)22/h4-10H,2-3,11H2,1H3 |
| InChIKey | SSGXETHXXLVIAX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 87.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|