C18H18N2 — CID 140531216
3-(1,2,3,4,5,6-hexahydroisoquinolin-1-yl)quinoline (PubChem CID 140531216) has the molecular formula C18H18N2 and a molecular weight of 262.36 g/mol. Its IUPAC name is 3-(1,2,3,4,5,6-hexahydroisoquinolin-1-yl)quinoline.
| Compound Name | 3-(1,2,3,4,5,6-hexahydroisoquinolin-1-yl)quinoline |
|---|---|
| PubChem CID | 140531216 |
| Molecular Formula | C18H18N2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 3-(1,2,3,4,5,6-hexahydroisoquinolin-1-yl)quinoline |
| SMILES | C1=CC2=C(CC1)CCNC2c1cnc2ccccc2c1 |
| InChI | InChI=1S/C18H18N2/c1-3-7-16-13(5-1)9-10-19-18(16)15-11-14-6-2-4-8-17(14)20-12-15/h2-4,6-8,11-12,18-19H,1,5,9-10H2 |
| InChIKey | GLIGRHGDGULGCJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |