C28H49N5O7 — CID 140531406
N-[(3S,6R)-6-(6-azidohexoxy)-1-methyl-2-oxoazepan-3-yl]-2-[(4R,5R,6R)-6-[(E)-3,3-dimethylbut-1-enyl]-5-hydroxy-2,2-dimethyl-1,3-dioxan-4-yl]-2-methoxyacetamide (PubChem CID 140531406) has the molecular formula C28H49N5O7 and a molecular weight of 567.73 g/mol. Its IUPAC name is N-[(3S,6R)-6-(6-azidohexoxy)-1-methyl-2-oxoazepan-3-yl]-2-[(4R,5R,6R)-6-[(E)-3,3-dimethylbut-1-enyl]-5-hydroxy-2,2-dimethyl-1,3-dioxan-4-yl]-2-methoxyacetamide.
| Compound Name | N-[(3S,6R)-6-(6-azidohexoxy)-1-methyl-2-oxoazepan-3-yl]-2-[(4R,5R,6R)-6-[(E)-3,3-dimethylbut-1-enyl]-5-hydroxy-2,2-dimethyl-1,3-dioxan-4-yl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 140531406 |
| Molecular Formula | C28H49N5O7 |
| Molecular Weight | 567.73 g/mol |
| Exact Mass | 567.36 |
| IUPAC Name | N-[(3S,6R)-6-(6-azidohexoxy)-1-methyl-2-oxoazepan-3-yl]-2-[(4R,5R,6R)-6-[(E)-3,3-dimethylbut-1-enyl]-5-hydroxy-2,2-dimethyl-1,3-dioxan-4-yl]-2-methoxyacetamide |
| SMILES | COC(C(=O)N[C@H]1CC[C@@H](OCCCCCCN=[N+]=[N-])CN(C)C1=O)[C@@H]1OC(C)(C)O[C@H](/C=C/C(C)(C)C)[C@H]1O |
| InChI | InChI=1S/C28H49N5O7/c1-27(2,3)15-14-21-22(34)23(40-28(4,5)39-21)24(37-7)25(35)31-20-13-12-19(18-33(6)26(20)36)38-17-11-9-8-10-16-30-32-29/h14-15,19-24,34H,8-13,16-18H2,1-7H3,(H,31,35)/b15-14+/t19-,20+,21-,22-,23-,24?/m1/s1 |
| InChIKey | MPFHGHDDJDRILZ-RWZVPWMISA-N |
| XLogP | 3.48 |
| TPSA | 155.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.73 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|