C16H20IN3S — CID 140531409
5-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-2-phenyl-1,3-thiazole;hydroiodide (PubChem CID 140531409) has the molecular formula C16H20IN3S and a molecular weight of 413.33 g/mol. Its IUPAC name is 5-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-2-phenyl-1,3-thiazole;hydroiodide.
| Compound Name | 5-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-2-phenyl-1,3-thiazole;hydroiodide |
|---|---|
| PubChem CID | 140531409 |
| Molecular Formula | C16H20IN3S |
| Molecular Weight | 413.33 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | 5-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-2-phenyl-1,3-thiazole;hydroiodide |
| SMILES | CN1CC2CN(c3cnc(-c4ccccc4)s3)CC2C1.I |
| InChI | InChI=1S/C16H19N3S.HI/c1-18-8-13-10-19(11-14(13)9-18)15-7-17-16(20-15)12-5-3-2-4-6-12;/h2-7,13-14H,8-11H2,1H3;1H |
| InChIKey | BRLBKCNFXDNJJH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|