C26H25F3N2O5 — CID 140531786
1-[7-[[(2E)-2-[8-(trifluoromethyl)-3,4-dihydro-2H-1-benzoxepin-5-ylidene]acetyl]amino]-3,4-dihydro-2H-quinolin-1-yl]ethyl 2-oxoacetate (PubChem CID 140531786) has the molecular formula C26H25F3N2O5 and a molecular weight of 502.49 g/mol. Its IUPAC name is 1-[7-[[(2E)-2-[8-(trifluoromethyl)-3,4-dihydro-2H-1-benzoxepin-5-ylidene]acetyl]amino]-3,4-dihydro-2H-quinolin-1-yl]ethyl 2-oxoacetate.
| Compound Name | 1-[7-[[(2E)-2-[8-(trifluoromethyl)-3,4-dihydro-2H-1-benzoxepin-5-ylidene]acetyl]amino]-3,4-dihydro-2H-quinolin-1-yl]ethyl 2-oxoacetate |
|---|---|
| PubChem CID | 140531786 |
| Molecular Formula | C26H25F3N2O5 |
| Molecular Weight | 502.49 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | 1-[7-[[(2E)-2-[8-(trifluoromethyl)-3,4-dihydro-2H-1-benzoxepin-5-ylidene]acetyl]amino]-3,4-dihydro-2H-quinolin-1-yl]ethyl 2-oxoacetate |
| SMILES | CC(OC(=O)C=O)N1CCCc2ccc(NC(=O)/C=C3\CCCOc4cc(C(F)(F)F)ccc43)cc21 |
| InChI | InChI=1S/C26H25F3N2O5/c1-16(36-25(34)15-32)31-10-2-4-17-6-8-20(14-22(17)31)30-24(33)12-18-5-3-11-35-23-13-19(26(27,28)29)7-9-21(18)23/h6-9,12-16H,2-5,10-11H2,1H3,(H,30,33)/b18-12+ |
| InChIKey | WCZAEUXUCCEVFH-LDADJPATSA-N |
| XLogP | 4.74 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|