2,4-dimethylimidazole-1-sulfonyl chloride

C5H7ClN2O2S — CID 140532409

IUPAC2,4-dimethylimidazole-1-sulfonyl chloride
SMILESCc1cn(S(=O)(=O)Cl)c(C)n1
InChIInChI=1S/C5H7ClN2O2S/c1-4-3-8(5(2)7-4)11(6,9)10/h3H,1-2H3
InChIKeyKKLKMWFPNWKZIG-UHFFFAOYSA-N
MW194.64 g/mol
LogP0.83
Rot. Bonds1

About 2,4-dimethylimidazole-1-sulfonyl chloride

2,4-dimethylimidazole-1-sulfonyl chloride (PubChem CID 140532409) has the molecular formula C5H7ClN2O2S and a molecular weight of 194.64 g/mol. Its IUPAC name is 2,4-dimethylimidazole-1-sulfonyl chloride.

Molecular Properties

Compound Name2,4-dimethylimidazole-1-sulfonyl chloride
PubChem CID140532409
Molecular FormulaC5H7ClN2O2S
Molecular Weight194.64 g/mol
Exact Mass193.99
IUPAC Name2,4-dimethylimidazole-1-sulfonyl chloride
SMILESCc1cn(S(=O)(=O)Cl)c(C)n1
InChIInChI=1S/C5H7ClN2O2S/c1-4-3-8(5(2)7-4)11(6,9)10/h3H,1-2H3
InChIKeyKKLKMWFPNWKZIG-UHFFFAOYSA-N
XLogP0.83
TPSA51.96 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.64
LogP ≤ 50.83
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 2,4-dimethylimidazole-1-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4-dimethylimidazole-1-sulfonyl chloride?
The IUPAC name of 2,4-dimethylimidazole-1-sulfonyl chloride (CID 140532409) is 2,4-dimethylimidazole-1-sulfonyl chloride.
What is the SMILES notation for 2,4-dimethylimidazole-1-sulfonyl chloride?
The canonical SMILES for 2,4-dimethylimidazole-1-sulfonyl chloride is Cc1cn(S(=O)(=O)Cl)c(C)n1.
What is the InChIKey of 2,4-dimethylimidazole-1-sulfonyl chloride?
The InChIKey is KKLKMWFPNWKZIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7ClN2O2S/c1-4-3-8(5(2)7-4)11(6,9)10/h3H,1-2H3.
What are the key properties of 2,4-dimethylimidazole-1-sulfonyl chloride?
2,4-dimethylimidazole-1-sulfonyl chloride has a molecular weight of 194.64 g/mol, XLogP of 0.83, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylimidazole-1-sulfonyl chloride is sourced from PubChem (CID 140532409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).