C28H47NO5 — CID 140532959
[(3S,4S,5Z)-3-[(2E,4E,6S)-7-[(2R,3R)-3-[(2R,3S)-3-hydroxypentan-2-yl]oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-4-methyl-1-oxa-2-azacyclododec-5-en-7-yl] acetate (PubChem CID 140532959) has the molecular formula C28H47NO5 and a molecular weight of 477.69 g/mol. Its IUPAC name is [(3S,4S,5Z)-3-[(2E,4E,6S)-7-[(2R,3R)-3-[(2R,3S)-3-hydroxypentan-2-yl]oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-4-methyl-1-oxa-2-azacyclododec-5-en-7-yl] acetate.
| Compound Name | [(3S,4S,5Z)-3-[(2E,4E,6S)-7-[(2R,3R)-3-[(2R,3S)-3-hydroxypentan-2-yl]oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-4-methyl-1-oxa-2-azacyclododec-5-en-7-yl] acetate |
|---|---|
| PubChem CID | 140532959 |
| Molecular Formula | C28H47NO5 |
| Molecular Weight | 477.69 g/mol |
| Exact Mass | 477.35 |
| IUPAC Name | [(3S,4S,5Z)-3-[(2E,4E,6S)-7-[(2R,3R)-3-[(2R,3S)-3-hydroxypentan-2-yl]oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-4-methyl-1-oxa-2-azacyclododec-5-en-7-yl] acetate |
| SMILES | CC[C@H](O)[C@@H](C)[C@H]1O[C@@H]1C[C@H](C)/C=C/C=C(\C)[C@H]1NOCCCCCC(OC(C)=O)/C=C\[C@@H]1C |
| InChI | InChI=1S/C28H47NO5/c1-7-25(31)22(5)28-26(34-28)18-19(2)12-11-13-20(3)27-21(4)15-16-24(33-23(6)30)14-9-8-10-17-32-29-27/h11-13,15-16,19,21-22,24-29,31H,7-10,14,17-18H2,1-6H3/b12-11+,16-15-,20-13+/t19-,21+,22-,24?,25+,26-,27-,28-/m1/s1 |
| InChIKey | QQNGGCUIOSYREI-QXXWYUERSA-N |
| XLogP | 5.28 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.69 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|