C10H13F3N4O3 — CID 140533193
[(2S)-2-amino-1-(dimethylamino)-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl] 2,2,2-trifluoroacetate (PubChem CID 140533193) has the molecular formula C10H13F3N4O3 and a molecular weight of 294.23 g/mol. Its IUPAC name is [(2S)-2-amino-1-(dimethylamino)-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(2S)-2-amino-1-(dimethylamino)-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140533193 |
| Molecular Formula | C10H13F3N4O3 |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | [(2S)-2-amino-1-(dimethylamino)-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl] 2,2,2-trifluoroacetate |
| SMILES | CN(C)C(=O)[C@](N)(Cc1cnc[nH]1)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C10H13F3N4O3/c1-17(2)7(18)9(14,3-6-4-15-5-16-6)20-8(19)10(11,12)13/h4-5H,3,14H2,1-2H3,(H,15,16)/t9-/m0/s1 |
| InChIKey | JUAYTNHKNPVOAK-VIFPVBQESA-N |
| XLogP | -0.20 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|