C9H15FO5 — CID 140533243
(2S,3R,4S)-2-[(1S)-1,2-dihydroxy-3-methylbut-2-enyl]-5-fluorooxolane-3,4-diol (PubChem CID 140533243) has the molecular formula C9H15FO5 and a molecular weight of 222.21 g/mol. Its IUPAC name is (2S,3R,4S)-2-[(1S)-1,2-dihydroxy-3-methylbut-2-enyl]-5-fluorooxolane-3,4-diol.
| Compound Name | (2S,3R,4S)-2-[(1S)-1,2-dihydroxy-3-methylbut-2-enyl]-5-fluorooxolane-3,4-diol |
|---|---|
| PubChem CID | 140533243 |
| Molecular Formula | C9H15FO5 |
| Molecular Weight | 222.21 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | (2S,3R,4S)-2-[(1S)-1,2-dihydroxy-3-methylbut-2-enyl]-5-fluorooxolane-3,4-diol |
| SMILES | CC(C)=C(O)[C@@H](O)[C@H]1OC(F)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C9H15FO5/c1-3(2)4(11)5(12)8-6(13)7(14)9(10)15-8/h5-9,11-14H,1-2H3/t5-,6-,7+,8-,9?/m1/s1 |
| InChIKey | JXPVNIOORPJBNE-LOFWALOHSA-N |
| XLogP | -0.38 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.21 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|