About (2S)-1,2-bis(2-bromocyclohexyl)ethane-1,2-diol
(2S)-1,2-bis(2-bromocyclohexyl)ethane-1,2-diol (PubChem CID 140533314) has the molecular formula C14H24Br2O2
and a molecular weight of 384.15 g/mol. Its IUPAC name is (2S)-1,2-bis(2-bromocyclohexyl)ethane-1,2-diol.
Molecular Properties
| Compound Name | (2S)-1,2-bis(2-bromocyclohexyl)ethane-1,2-diol |
| PubChem CID | 140533314 |
| Molecular Formula | C14H24Br2O2 |
| Molecular Weight | 384.15 g/mol |
| Exact Mass | 382.01 |
| IUPAC Name | (2S)-1,2-bis(2-bromocyclohexyl)ethane-1,2-diol |
| SMILES | OC(C1CCCCC1Br)[C@@H](O)C1CCCCC1Br |
| InChI | InChI=1S/C14H24Br2O2/c15-11-7-3-1-5-9(11)13(17)14(18)10-6-2-4-8-12(10)16/h9-14,17-18H,1-8H2/t9?,10?,11?,12?,13-,14?/m0/s1 |
| InChIKey | WHLDAHAVCYEFDS-QBBLGZLKSA-N |
| XLogP | 3.62 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.15 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1,2-bis(2-bromocyclohexyl)ethane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1,2-bis(2-bromocyclohexyl)ethane-1,2-diol?
The IUPAC name of (2S)-1,2-bis(2-bromocyclohexyl)ethane-1,2-diol (CID 140533314) is (2S)-1,2-bis(2-bromocyclohexyl)ethane-1,2-diol.
What is the SMILES notation for (2S)-1,2-bis(2-bromocyclohexyl)ethane-1,2-diol?
The canonical SMILES for (2S)-1,2-bis(2-bromocyclohexyl)ethane-1,2-diol is OC(C1CCCCC1Br)[C@@H](O)C1CCCCC1Br.
What is the InChIKey of (2S)-1,2-bis(2-bromocyclohexyl)ethane-1,2-diol?
The InChIKey is WHLDAHAVCYEFDS-QBBLGZLKSA-N. The full InChI is InChI=1S/C14H24Br2O2/c15-11-7-3-1-5-9(11)13(17)14(18)10-6-2-4-8-12(10)16/h9-14,17-18H,1-8H2/t9?,10?,11?,12?,13-,14?/m0/s1.
What are the key properties of (2S)-1,2-bis(2-bromocyclohexyl)ethane-1,2-diol?
(2S)-1,2-bis(2-bromocyclohexyl)ethane-1,2-diol has a molecular weight of 384.15 g/mol, XLogP of 3.62, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1,2-bis(2-bromocyclohexyl)ethane-1,2-diol is sourced from PubChem (CID 140533314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).