C25H30N2O5S — CID 140533445
2-[(2-tert-butyl-1,1,3-trioxo-5-phenyl-1,2-thiazol-4-yl)amino]ethyl 2-(2,6-dimethylphenyl)acetate (PubChem CID 140533445) has the molecular formula C25H30N2O5S and a molecular weight of 470.59 g/mol. Its IUPAC name is 2-[(2-tert-butyl-1,1,3-trioxo-5-phenyl-1,2-thiazol-4-yl)amino]ethyl 2-(2,6-dimethylphenyl)acetate.
| Compound Name | 2-[(2-tert-butyl-1,1,3-trioxo-5-phenyl-1,2-thiazol-4-yl)amino]ethyl 2-(2,6-dimethylphenyl)acetate |
|---|---|
| PubChem CID | 140533445 |
| Molecular Formula | C25H30N2O5S |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 2-[(2-tert-butyl-1,1,3-trioxo-5-phenyl-1,2-thiazol-4-yl)amino]ethyl 2-(2,6-dimethylphenyl)acetate |
| SMILES | Cc1cccc(C)c1CC(=O)OCCNC1=C(c2ccccc2)S(=O)(=O)N(C(C)(C)C)C1=O |
| InChI | InChI=1S/C25H30N2O5S/c1-17-10-9-11-18(2)20(17)16-21(28)32-15-14-26-22-23(19-12-7-6-8-13-19)33(30,31)27(24(22)29)25(3,4)5/h6-13,26H,14-16H2,1-5H3 |
| InChIKey | BFCLEQKACCTAOE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|