C8H9FO — CID 140534070
2-fluoro-2,3,4,5-tetrahydro-1-benzofuran (PubChem CID 140534070) has the molecular formula C8H9FO and a molecular weight of 140.16 g/mol. Its IUPAC name is 2-fluoro-2,3,4,5-tetrahydro-1-benzofuran.
| Compound Name | 2-fluoro-2,3,4,5-tetrahydro-1-benzofuran |
|---|---|
| PubChem CID | 140534070 |
| Molecular Formula | C8H9FO |
| Molecular Weight | 140.16 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | 2-fluoro-2,3,4,5-tetrahydro-1-benzofuran |
| SMILES | FC1CC2=C(C=CCC2)O1 |
| InChI | InChI=1S/C8H9FO/c9-8-5-6-3-1-2-4-7(6)10-8/h2,4,8H,1,3,5H2 |
| InChIKey | CHCJTILBFKRKQP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.16 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |