C27H30ClNO6S — CID 140534768
8-chloro-9-[[4-(3,3-dimethyl-2-oxobutoxy)phenyl]methylsulfanyl]spiro[1,2,3,4-tetrahydro-3-benzazepine-5,2'-1,3-dioxepane]-4',7'-dione (PubChem CID 140534768) has the molecular formula C27H30ClNO6S and a molecular weight of 532.06 g/mol. Its IUPAC name is 8-chloro-9-[[4-(3,3-dimethyl-2-oxobutoxy)phenyl]methylsulfanyl]spiro[1,2,3,4-tetrahydro-3-benzazepine-5,2'-1,3-dioxepane]-4',7'-dione.
| Compound Name | 8-chloro-9-[[4-(3,3-dimethyl-2-oxobutoxy)phenyl]methylsulfanyl]spiro[1,2,3,4-tetrahydro-3-benzazepine-5,2'-1,3-dioxepane]-4',7'-dione |
|---|---|
| PubChem CID | 140534768 |
| Molecular Formula | C27H30ClNO6S |
| Molecular Weight | 532.06 g/mol |
| Exact Mass | 531.15 |
| IUPAC Name | 8-chloro-9-[[4-(3,3-dimethyl-2-oxobutoxy)phenyl]methylsulfanyl]spiro[1,2,3,4-tetrahydro-3-benzazepine-5,2'-1,3-dioxepane]-4',7'-dione |
| SMILES | CC(C)(C)C(=O)COc1ccc(CSc2c(Cl)ccc3c2CCNCC32OC(=O)CCC(=O)O2)cc1 |
| InChI | InChI=1S/C27H30ClNO6S/c1-26(2,3)22(30)14-33-18-6-4-17(5-7-18)15-36-25-19-12-13-29-16-27(20(19)8-9-21(25)28)34-23(31)10-11-24(32)35-27/h4-9,29H,10-16H2,1-3H3 |
| InChIKey | OKYMXTMZQAUGLY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.06 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |