C26H27ClN2O5S — CID 140534796
8-chloro-9-[3-(2-oxo-3,4-dihydroquinolin-1-yl)propylsulfanyl]spiro[1,2,3,4-tetrahydro-3-benzazepine-5,2'-1,3-dioxepane]-4',7'-dione (PubChem CID 140534796) has the molecular formula C26H27ClN2O5S and a molecular weight of 515.03 g/mol. Its IUPAC name is 8-chloro-9-[3-(2-oxo-3,4-dihydroquinolin-1-yl)propylsulfanyl]spiro[1,2,3,4-tetrahydro-3-benzazepine-5,2'-1,3-dioxepane]-4',7'-dione.
| Compound Name | 8-chloro-9-[3-(2-oxo-3,4-dihydroquinolin-1-yl)propylsulfanyl]spiro[1,2,3,4-tetrahydro-3-benzazepine-5,2'-1,3-dioxepane]-4',7'-dione |
|---|---|
| PubChem CID | 140534796 |
| Molecular Formula | C26H27ClN2O5S |
| Molecular Weight | 515.03 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | 8-chloro-9-[3-(2-oxo-3,4-dihydroquinolin-1-yl)propylsulfanyl]spiro[1,2,3,4-tetrahydro-3-benzazepine-5,2'-1,3-dioxepane]-4',7'-dione |
| SMILES | O=C1CCC(=O)OC2(CNCCc3c2ccc(Cl)c3SCCCN2C(=O)CCc3ccccc32)O1 |
| InChI | InChI=1S/C26H27ClN2O5S/c27-20-8-7-19-18(12-13-28-16-26(19)33-23(31)10-11-24(32)34-26)25(20)35-15-3-14-29-21-5-2-1-4-17(21)6-9-22(29)30/h1-2,4-5,7-8,28H,3,6,9-16H2 |
| InChIKey | GPYHXJBWDRFXMM-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.03 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|