C18H23ClN2O5 — CID 140534804
8-chloro-9-(2-ethoxyethylamino)spiro[1,2,3,4-tetrahydro-3-benzazepine-5,2'-1,3-dioxepane]-4',7'-dione (PubChem CID 140534804) has the molecular formula C18H23ClN2O5 and a molecular weight of 382.84 g/mol. Its IUPAC name is 8-chloro-9-(2-ethoxyethylamino)spiro[1,2,3,4-tetrahydro-3-benzazepine-5,2'-1,3-dioxepane]-4',7'-dione.
| Compound Name | 8-chloro-9-(2-ethoxyethylamino)spiro[1,2,3,4-tetrahydro-3-benzazepine-5,2'-1,3-dioxepane]-4',7'-dione |
|---|---|
| PubChem CID | 140534804 |
| Molecular Formula | C18H23ClN2O5 |
| Molecular Weight | 382.84 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 8-chloro-9-(2-ethoxyethylamino)spiro[1,2,3,4-tetrahydro-3-benzazepine-5,2'-1,3-dioxepane]-4',7'-dione |
| SMILES | CCOCCNc1c(Cl)ccc2c1CCNCC21OC(=O)CCC(=O)O1 |
| InChI | InChI=1S/C18H23ClN2O5/c1-2-24-10-9-21-17-12-7-8-20-11-18(13(12)3-4-14(17)19)25-15(22)5-6-16(23)26-18/h3-4,20-21H,2,5-11H2,1H3 |
| InChIKey | BFJPMLWCLBGJFU-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.84 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|