C28H27ClN2O4S — CID 140534863
9-[(4-benzylsulfanylphenyl)methylamino]-8-chlorospiro[1,2,3,4-tetrahydro-3-benzazepine-5,2'-1,3-dioxepane]-4',7'-dione (PubChem CID 140534863) has the molecular formula C28H27ClN2O4S and a molecular weight of 523.05 g/mol. Its IUPAC name is 9-[(4-benzylsulfanylphenyl)methylamino]-8-chlorospiro[1,2,3,4-tetrahydro-3-benzazepine-5,2'-1,3-dioxepane]-4',7'-dione.
| Compound Name | 9-[(4-benzylsulfanylphenyl)methylamino]-8-chlorospiro[1,2,3,4-tetrahydro-3-benzazepine-5,2'-1,3-dioxepane]-4',7'-dione |
|---|---|
| PubChem CID | 140534863 |
| Molecular Formula | C28H27ClN2O4S |
| Molecular Weight | 523.05 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | 9-[(4-benzylsulfanylphenyl)methylamino]-8-chlorospiro[1,2,3,4-tetrahydro-3-benzazepine-5,2'-1,3-dioxepane]-4',7'-dione |
| SMILES | O=C1CCC(=O)OC2(CNCCc3c2ccc(Cl)c3NCc2ccc(SCc3ccccc3)cc2)O1 |
| InChI | InChI=1S/C28H27ClN2O4S/c29-24-11-10-23-22(14-15-30-18-28(23)34-25(32)12-13-26(33)35-28)27(24)31-16-19-6-8-21(9-7-19)36-17-20-4-2-1-3-5-20/h1-11,30-31H,12-18H2 |
| InChIKey | JXIWEHDLVHQZLO-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.05 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |