C24H23ClF5N3O5 — CID 140534870
8-chloro-9-[[4-(3,3,4,4,4-pentafluorobutan-2-yloxy)-2-pyridinyl]methylamino]spiro[1,2,3,4-tetrahydro-3-benzazepine-5,2'-1,3-dioxepane]-4',7'-dione (PubChem CID 140534870) has the molecular formula C24H23ClF5N3O5 and a molecular weight of 563.91 g/mol. Its IUPAC name is 8-chloro-9-[[4-(3,3,4,4,4-pentafluorobutan-2-yloxy)-2-pyridinyl]methylamino]spiro[1,2,3,4-tetrahydro-3-benzazepine-5,2'-1,3-dioxepane]-4',7'-dione.
| Compound Name | 8-chloro-9-[[4-(3,3,4,4,4-pentafluorobutan-2-yloxy)-2-pyridinyl]methylamino]spiro[1,2,3,4-tetrahydro-3-benzazepine-5,2'-1,3-dioxepane]-4',7'-dione |
|---|---|
| PubChem CID | 140534870 |
| Molecular Formula | C24H23ClF5N3O5 |
| Molecular Weight | 563.91 g/mol |
| Exact Mass | 563.12 |
| IUPAC Name | 8-chloro-9-[[4-(3,3,4,4,4-pentafluorobutan-2-yloxy)-2-pyridinyl]methylamino]spiro[1,2,3,4-tetrahydro-3-benzazepine-5,2'-1,3-dioxepane]-4',7'-dione |
| SMILES | CC(Oc1ccnc(CNc2c(Cl)ccc3c2CCNCC32OC(=O)CCC(=O)O2)c1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C24H23ClF5N3O5/c1-13(23(26,27)24(28,29)30)36-15-6-9-32-14(10-15)11-33-21-16-7-8-31-12-22(17(16)2-3-18(21)25)37-19(34)4-5-20(35)38-22/h2-3,6,9-10,13,31,33H,4-5,7-8,11-12H2,1H3 |
| InChIKey | HNSCLUZUFNPNLT-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.91 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|