C27H29ClN2O5S — CID 140534915
8-chloro-9-[4-(2-oxo-3,4-dihydroquinolin-1-yl)butylsulfanyl]spiro[1,2,3,4-tetrahydro-3-benzazepine-5,2'-1,3-dioxepane]-4',7'-dione (PubChem CID 140534915) has the molecular formula C27H29ClN2O5S and a molecular weight of 529.06 g/mol. Its IUPAC name is 8-chloro-9-[4-(2-oxo-3,4-dihydroquinolin-1-yl)butylsulfanyl]spiro[1,2,3,4-tetrahydro-3-benzazepine-5,2'-1,3-dioxepane]-4',7'-dione.
| Compound Name | 8-chloro-9-[4-(2-oxo-3,4-dihydroquinolin-1-yl)butylsulfanyl]spiro[1,2,3,4-tetrahydro-3-benzazepine-5,2'-1,3-dioxepane]-4',7'-dione |
|---|---|
| PubChem CID | 140534915 |
| Molecular Formula | C27H29ClN2O5S |
| Molecular Weight | 529.06 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | 8-chloro-9-[4-(2-oxo-3,4-dihydroquinolin-1-yl)butylsulfanyl]spiro[1,2,3,4-tetrahydro-3-benzazepine-5,2'-1,3-dioxepane]-4',7'-dione |
| SMILES | O=C1CCC(=O)OC2(CNCCc3c2ccc(Cl)c3SCCCCN2C(=O)CCc3ccccc32)O1 |
| InChI | InChI=1S/C27H29ClN2O5S/c28-21-9-8-20-19(13-14-29-17-27(20)34-24(32)11-12-25(33)35-27)26(21)36-16-4-3-15-30-22-6-2-1-5-18(22)7-10-23(30)31/h1-2,5-6,8-9,29H,3-4,7,10-17H2 |
| InChIKey | RZPWCQWNOZEKFT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.06 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|