C12H9F14NS — CID 140535134
4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-[tetrafluoro(1,1,2-trifluoropropyl)-λ6-sulfanyl]aniline (PubChem CID 140535134) has the molecular formula C12H9F14NS and a molecular weight of 465.25 g/mol. Its IUPAC name is 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-[tetrafluoro(1,1,2-trifluoropropyl)-λ6-sulfanyl]aniline.
| Compound Name | 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-[tetrafluoro(1,1,2-trifluoropropyl)-λ6-sulfanyl]aniline |
|---|---|
| PubChem CID | 140535134 |
| Molecular Formula | C12H9F14NS |
| Molecular Weight | 465.25 g/mol |
| Exact Mass | 465.02 |
| IUPAC Name | 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-[tetrafluoro(1,1,2-trifluoropropyl)-λ6-sulfanyl]aniline |
| SMILES | CC(F)C(F)(F)S(F)(F)(F)(F)c1cc(C(F)(C(F)(F)F)C(F)(F)F)ccc1N |
| InChI | InChI=1S/C12H9F14NS/c1-5(13)10(15,16)28(23,24,25,26)8-4-6(2-3-7(8)27)9(14,11(17,18)19)12(20,21)22/h2-5H,27H2,1H3 |
| InChIKey | VJVNEUKGXYLIBG-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.25 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|