C11H8BrF12NS — CID 140535144
2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-[tetrafluoro(1-fluoroethyl)-λ6-sulfanyl]aniline (PubChem CID 140535144) has the molecular formula C11H8BrF12NS and a molecular weight of 494.14 g/mol. Its IUPAC name is 2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-[tetrafluoro(1-fluoroethyl)-λ6-sulfanyl]aniline.
| Compound Name | 2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-[tetrafluoro(1-fluoroethyl)-λ6-sulfanyl]aniline |
|---|---|
| PubChem CID | 140535144 |
| Molecular Formula | C11H8BrF12NS |
| Molecular Weight | 494.14 g/mol |
| Exact Mass | 492.94 |
| IUPAC Name | 2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-[tetrafluoro(1-fluoroethyl)-λ6-sulfanyl]aniline |
| SMILES | CC(F)S(F)(F)(F)(F)c1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(Br)c1N |
| InChI | InChI=1S/C11H8BrF12NS/c1-4(13)26(21,22,23,24)7-3-5(2-6(12)8(7)25)9(14,10(15,16)17)11(18,19)20/h2-4H,25H2,1H3 |
| InChIKey | IAJFNDMJQLUBNO-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.14 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|