C32H72O6Si4 — CID 140535876
2-[(4R,5R)-3,4,5-tris(triethylsilyloxy)-6-(triethylsilyloxymethyl)oxan-2-yl]ethanol (PubChem CID 140535876) has the molecular formula C32H72O6Si4 and a molecular weight of 665.27 g/mol. Its IUPAC name is 2-[(4R,5R)-3,4,5-tris(triethylsilyloxy)-6-(triethylsilyloxymethyl)oxan-2-yl]ethanol.
| Compound Name | 2-[(4R,5R)-3,4,5-tris(triethylsilyloxy)-6-(triethylsilyloxymethyl)oxan-2-yl]ethanol |
|---|---|
| PubChem CID | 140535876 |
| Molecular Formula | C32H72O6Si4 |
| Molecular Weight | 665.27 g/mol |
| Exact Mass | 664.44 |
| IUPAC Name | 2-[(4R,5R)-3,4,5-tris(triethylsilyloxy)-6-(triethylsilyloxymethyl)oxan-2-yl]ethanol |
| SMILES | CC[Si](CC)(CC)OCC1OC(CCO)C(O[Si](CC)(CC)CC)[C@@H](O[Si](CC)(CC)CC)[C@@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C32H72O6Si4/c1-13-39(14-2,15-3)34-27-29-31(37-41(19-7,20-8)21-9)32(38-42(22-10,23-11)24-12)30(28(35-29)25-26-33)36-40(16-4,17-5)18-6/h28-33H,13-27H2,1-12H3/t28?,29?,30?,31-,32-/m1/s1 |
| InChIKey | GODFWIRCRVSGAD-LQJXKLSQSA-N |
| XLogP | 9.33 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.27 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|