About (6-amino-2-butoxy-8-methoxypurin-7-yl) 2,2,2-trifluoroacetate
(6-amino-2-butoxy-8-methoxypurin-7-yl) 2,2,2-trifluoroacetate (PubChem CID 140536089) has the molecular formula C12H14F3N5O4
and a molecular weight of 349.27 g/mol. Its IUPAC name is (6-amino-2-butoxy-8-methoxypurin-7-yl) 2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | (6-amino-2-butoxy-8-methoxypurin-7-yl) 2,2,2-trifluoroacetate |
| PubChem CID | 140536089 |
| Molecular Formula | C12H14F3N5O4 |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | (6-amino-2-butoxy-8-methoxypurin-7-yl) 2,2,2-trifluoroacetate |
| SMILES | CCCCOc1nc(N)c2c(n1)nc(OC)n2OC(=O)C(F)(F)F |
| InChI | InChI=1S/C12H14F3N5O4/c1-3-4-5-23-10-17-7(16)6-8(18-10)19-11(22-2)20(6)24-9(21)12(13,14)15/h3-5H2,1-2H3,(H2,16,17,18) |
| InChIKey | OUWFMENXYAKPDR-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (6-amino-2-butoxy-8-methoxypurin-7-yl) 2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-amino-2-butoxy-8-methoxypurin-7-yl) 2,2,2-trifluoroacetate?
The IUPAC name of (6-amino-2-butoxy-8-methoxypurin-7-yl) 2,2,2-trifluoroacetate (CID 140536089) is (6-amino-2-butoxy-8-methoxypurin-7-yl) 2,2,2-trifluoroacetate.
What is the SMILES notation for (6-amino-2-butoxy-8-methoxypurin-7-yl) 2,2,2-trifluoroacetate?
The canonical SMILES for (6-amino-2-butoxy-8-methoxypurin-7-yl) 2,2,2-trifluoroacetate is CCCCOc1nc(N)c2c(n1)nc(OC)n2OC(=O)C(F)(F)F.
What is the InChIKey of (6-amino-2-butoxy-8-methoxypurin-7-yl) 2,2,2-trifluoroacetate?
The InChIKey is OUWFMENXYAKPDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F3N5O4/c1-3-4-5-23-10-17-7(16)6-8(18-10)19-11(22-2)20(6)24-9(21)12(13,14)15/h3-5H2,1-2H3,(H2,16,17,18).
What are the key properties of (6-amino-2-butoxy-8-methoxypurin-7-yl) 2,2,2-trifluoroacetate?
(6-amino-2-butoxy-8-methoxypurin-7-yl) 2,2,2-trifluoroacetate has a molecular weight of 349.27 g/mol, XLogP of 1.11, 6 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for (6-amino-2-butoxy-8-methoxypurin-7-yl) 2,2,2-trifluoroacetate is sourced from PubChem (CID 140536089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).