C12H21N5O4 — CID 140537499
ethyl 2-[[1-[2-(dimethylamino)ethyl]-4-imino-2,6-dioxo-1,3-diazinan-5-yl]amino]acetate (PubChem CID 140537499) has the molecular formula C12H21N5O4 and a molecular weight of 299.33 g/mol. Its IUPAC name is ethyl 2-[[1-[2-(dimethylamino)ethyl]-4-imino-2,6-dioxo-1,3-diazinan-5-yl]amino]acetate.
| Compound Name | ethyl 2-[[1-[2-(dimethylamino)ethyl]-4-imino-2,6-dioxo-1,3-diazinan-5-yl]amino]acetate |
|---|---|
| PubChem CID | 140537499 |
| Molecular Formula | C12H21N5O4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | ethyl 2-[[1-[2-(dimethylamino)ethyl]-4-imino-2,6-dioxo-1,3-diazinan-5-yl]amino]acetate |
| SMILES | [H]/N=C1\NC(=O)N(CCN(C)C)C(=O)C1NCC(=O)OCC |
| InChI | InChI=1S/C12H21N5O4/c1-4-21-8(18)7-14-9-10(13)15-12(20)17(11(9)19)6-5-16(2)3/h9,14H,4-7H2,1-3H3,(H2,13,15,20) |
| InChIKey | YLYPKUYONLLNFE-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 114.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|