About ethyl 2-[(4-imino-2,6-dioxo-1-propyl-1,3-diazinan-5-yl)amino]acetate
ethyl 2-[(4-imino-2,6-dioxo-1-propyl-1,3-diazinan-5-yl)amino]acetate (PubChem CID 140537500) has the molecular formula C11H18N4O4
and a molecular weight of 270.29 g/mol. Its IUPAC name is ethyl 2-[(4-imino-2,6-dioxo-1-propyl-1,3-diazinan-5-yl)amino]acetate.
Molecular Properties
| Compound Name | ethyl 2-[(4-imino-2,6-dioxo-1-propyl-1,3-diazinan-5-yl)amino]acetate |
| PubChem CID | 140537500 |
| Molecular Formula | C11H18N4O4 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | ethyl 2-[(4-imino-2,6-dioxo-1-propyl-1,3-diazinan-5-yl)amino]acetate |
| SMILES | [H]/N=C1\NC(=O)N(CCC)C(=O)C1NCC(=O)OCC |
| InChI | InChI=1S/C11H18N4O4/c1-3-5-15-10(17)8(9(12)14-11(15)18)13-6-7(16)19-4-2/h8,13H,3-6H2,1-2H3,(H2,12,14,18) |
| InChIKey | HADYMMBRCZWLKI-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 111.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[(4-imino-2,6-dioxo-1-propyl-1,3-diazinan-5-yl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(4-imino-2,6-dioxo-1-propyl-1,3-diazinan-5-yl)amino]acetate?
The IUPAC name of ethyl 2-[(4-imino-2,6-dioxo-1-propyl-1,3-diazinan-5-yl)amino]acetate (CID 140537500) is ethyl 2-[(4-imino-2,6-dioxo-1-propyl-1,3-diazinan-5-yl)amino]acetate.
What is the SMILES notation for ethyl 2-[(4-imino-2,6-dioxo-1-propyl-1,3-diazinan-5-yl)amino]acetate?
The canonical SMILES for ethyl 2-[(4-imino-2,6-dioxo-1-propyl-1,3-diazinan-5-yl)amino]acetate is [H]/N=C1\NC(=O)N(CCC)C(=O)C1NCC(=O)OCC.
What is the InChIKey of ethyl 2-[(4-imino-2,6-dioxo-1-propyl-1,3-diazinan-5-yl)amino]acetate?
The InChIKey is HADYMMBRCZWLKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4O4/c1-3-5-15-10(17)8(9(12)14-11(15)18)13-6-7(16)19-4-2/h8,13H,3-6H2,1-2H3,(H2,12,14,18).
What are the key properties of ethyl 2-[(4-imino-2,6-dioxo-1-propyl-1,3-diazinan-5-yl)amino]acetate?
ethyl 2-[(4-imino-2,6-dioxo-1-propyl-1,3-diazinan-5-yl)amino]acetate has a molecular weight of 270.29 g/mol, XLogP of -0.55, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(4-imino-2,6-dioxo-1-propyl-1,3-diazinan-5-yl)amino]acetate is sourced from PubChem (CID 140537500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).