C34H62O5Si2 — CID 140537687
(2,4-dimethylcyclohexa-2,4-dien-1-yl) (3S,6R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-4,4,6,8-tetramethyl-5-oxo-3-triethylsilyloxydec-9-enoate (PubChem CID 140537687) has the molecular formula C34H62O5Si2 and a molecular weight of 607.04 g/mol. Its IUPAC name is (2,4-dimethylcyclohexa-2,4-dien-1-yl) (3S,6R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-4,4,6,8-tetramethyl-5-oxo-3-triethylsilyloxydec-9-enoate.
| Compound Name | (2,4-dimethylcyclohexa-2,4-dien-1-yl) (3S,6R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-4,4,6,8-tetramethyl-5-oxo-3-triethylsilyloxydec-9-enoate |
|---|---|
| PubChem CID | 140537687 |
| Molecular Formula | C34H62O5Si2 |
| Molecular Weight | 607.04 g/mol |
| Exact Mass | 606.41 |
| IUPAC Name | (2,4-dimethylcyclohexa-2,4-dien-1-yl) (3S,6R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-4,4,6,8-tetramethyl-5-oxo-3-triethylsilyloxydec-9-enoate |
| SMILES | C=C[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)C(C)(C)[C@H](CC(=O)OC1CC=C(C)C=C1C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C34H62O5Si2/c1-16-25(6)31(39-40(14,15)33(9,10)11)27(8)32(36)34(12,13)29(38-41(17-2,18-3)19-4)23-30(35)37-28-21-20-24(5)22-26(28)7/h16,20,22,25,27-29,31H,1,17-19,21,23H2,2-15H3/t25-,27+,28?,29-,31-/m0/s1 |
| InChIKey | HGOOCXWTKBECPT-UKANLGETSA-N |
| XLogP | 9.42 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.04 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|