C12H13Cl3N2O — CID 140538752
4-chloro-N-(4-chlorophenyl)-3,3-dimethyl-2-oxobutanehydrazonoyl chloride (PubChem CID 140538752) has the molecular formula C12H13Cl3N2O and a molecular weight of 307.61 g/mol. Its IUPAC name is 4-chloro-N-(4-chlorophenyl)-3,3-dimethyl-2-oxobutanehydrazonoyl chloride.
| Compound Name | 4-chloro-N-(4-chlorophenyl)-3,3-dimethyl-2-oxobutanehydrazonoyl chloride |
|---|---|
| PubChem CID | 140538752 |
| Molecular Formula | C12H13Cl3N2O |
| Molecular Weight | 307.61 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 4-chloro-N-(4-chlorophenyl)-3,3-dimethyl-2-oxobutanehydrazonoyl chloride |
| SMILES | CC(C)(CCl)C(=O)C(Cl)=NNc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H13Cl3N2O/c1-12(2,7-13)10(18)11(15)17-16-9-5-3-8(14)4-6-9/h3-6,16H,7H2,1-2H3 |
| InChIKey | UKZJDFDIIYUHLP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.61 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|