C25H18F3N3O5 — CID 140539043
[2-[2-amino-4-[3-(1,3-benzodioxol-5-yl)phenyl]-1-methyl-5-oxoimidazol-4-yl]phenyl] 2,2,2-trifluoroacetate (PubChem CID 140539043) has the molecular formula C25H18F3N3O5 and a molecular weight of 497.43 g/mol. Its IUPAC name is [2-[2-amino-4-[3-(1,3-benzodioxol-5-yl)phenyl]-1-methyl-5-oxoimidazol-4-yl]phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[2-amino-4-[3-(1,3-benzodioxol-5-yl)phenyl]-1-methyl-5-oxoimidazol-4-yl]phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140539043 |
| Molecular Formula | C25H18F3N3O5 |
| Molecular Weight | 497.43 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | [2-[2-amino-4-[3-(1,3-benzodioxol-5-yl)phenyl]-1-methyl-5-oxoimidazol-4-yl]phenyl] 2,2,2-trifluoroacetate |
| SMILES | CN1C(=O)C(c2cccc(-c3ccc4c(c3)OCO4)c2)(c2ccccc2OC(=O)C(F)(F)F)N=C1N |
| InChI | InChI=1S/C25H18F3N3O5/c1-31-21(32)24(30-23(31)29,17-7-2-3-8-18(17)36-22(33)25(26,27)28)16-6-4-5-14(11-16)15-9-10-19-20(12-15)35-13-34-19/h2-12H,13H2,1H3,(H2,29,30) |
| InChIKey | JTIWTDDMVTVYDG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|