About (3-acetyl-2-hydroxybenzoyl) 3-acetyl-4-[1-(diethylamino)ethyl]-2,5-dihydroxybenzoate
(3-acetyl-2-hydroxybenzoyl) 3-acetyl-4-[1-(diethylamino)ethyl]-2,5-dihydroxybenzoate (PubChem CID 140539545) has the molecular formula C24H27NO8
and a molecular weight of 457.48 g/mol. Its IUPAC name is (3-acetyl-2-hydroxybenzoyl) 3-acetyl-4-[1-(diethylamino)ethyl]-2,5-dihydroxybenzoate.
Molecular Properties
| Compound Name | (3-acetyl-2-hydroxybenzoyl) 3-acetyl-4-[1-(diethylamino)ethyl]-2,5-dihydroxybenzoate |
| PubChem CID | 140539545 |
| Molecular Formula | C24H27NO8 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | (3-acetyl-2-hydroxybenzoyl) 3-acetyl-4-[1-(diethylamino)ethyl]-2,5-dihydroxybenzoate |
| SMILES | CCN(CC)C(C)c1c(O)cc(C(=O)OC(=O)c2cccc(C(C)=O)c2O)c(O)c1C(C)=O |
| InChI | InChI=1S/C24H27NO8/c1-6-25(7-2)12(3)19-18(28)11-17(22(30)20(19)14(5)27)24(32)33-23(31)16-10-8-9-15(13(4)26)21(16)29/h8-12,28-30H,6-7H2,1-5H3 |
| InChIKey | SWWKHGFILFSADF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 141.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze (3-acetyl-2-hydroxybenzoyl) 3-acetyl-4-[1-(diethylamino)ethyl]-2,5-dihydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-acetyl-2-hydroxybenzoyl) 3-acetyl-4-[1-(diethylamino)ethyl]-2,5-dihydroxybenzoate?
The IUPAC name of (3-acetyl-2-hydroxybenzoyl) 3-acetyl-4-[1-(diethylamino)ethyl]-2,5-dihydroxybenzoate (CID 140539545) is (3-acetyl-2-hydroxybenzoyl) 3-acetyl-4-[1-(diethylamino)ethyl]-2,5-dihydroxybenzoate.
What is the SMILES notation for (3-acetyl-2-hydroxybenzoyl) 3-acetyl-4-[1-(diethylamino)ethyl]-2,5-dihydroxybenzoate?
The canonical SMILES for (3-acetyl-2-hydroxybenzoyl) 3-acetyl-4-[1-(diethylamino)ethyl]-2,5-dihydroxybenzoate is CCN(CC)C(C)c1c(O)cc(C(=O)OC(=O)c2cccc(C(C)=O)c2O)c(O)c1C(C)=O.
What is the InChIKey of (3-acetyl-2-hydroxybenzoyl) 3-acetyl-4-[1-(diethylamino)ethyl]-2,5-dihydroxybenzoate?
The InChIKey is SWWKHGFILFSADF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27NO8/c1-6-25(7-2)12(3)19-18(28)11-17(22(30)20(19)14(5)27)24(32)33-23(31)16-10-8-9-15(13(4)26)21(16)29/h8-12,28-30H,6-7H2,1-5H3.
What are the key properties of (3-acetyl-2-hydroxybenzoyl) 3-acetyl-4-[1-(diethylamino)ethyl]-2,5-dihydroxybenzoate?
(3-acetyl-2-hydroxybenzoyl) 3-acetyl-4-[1-(diethylamino)ethyl]-2,5-dihydroxybenzoate has a molecular weight of 457.48 g/mol, XLogP of 3.61, 8 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for (3-acetyl-2-hydroxybenzoyl) 3-acetyl-4-[1-(diethylamino)ethyl]-2,5-dihydroxybenzoate is sourced from PubChem (CID 140539545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).