C18H31N3O3 — CID 140539567
4-[2-(1-hydroxy-2-methylprop-2-enoxy)ethyl]-2-(7,8,9-triazatricyclo[4.3.0.07,9]nonan-8-yl)cyclohexan-1-ol (PubChem CID 140539567) has the molecular formula C18H31N3O3 and a molecular weight of 337.46 g/mol. Its IUPAC name is 4-[2-(1-hydroxy-2-methylprop-2-enoxy)ethyl]-2-(7,8,9-triazatricyclo[4.3.0.07,9]nonan-8-yl)cyclohexan-1-ol.
| Compound Name | 4-[2-(1-hydroxy-2-methylprop-2-enoxy)ethyl]-2-(7,8,9-triazatricyclo[4.3.0.07,9]nonan-8-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 140539567 |
| Molecular Formula | C18H31N3O3 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | 4-[2-(1-hydroxy-2-methylprop-2-enoxy)ethyl]-2-(7,8,9-triazatricyclo[4.3.0.07,9]nonan-8-yl)cyclohexan-1-ol |
| SMILES | C=C(C)C(O)OCCC1CCC(O)C(n2n3n2C2CCCCC23)C1 |
| InChI | InChI=1S/C18H31N3O3/c1-12(2)18(23)24-10-9-13-7-8-17(22)16(11-13)21-19-14-5-3-4-6-15(14)20(19)21/h13-18,22-23H,1,3-11H2,2H3 |
| InChIKey | DKOHTYDRNCHYJK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 64.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|